C19H29ClN4O — CID 119704768
N-(1-benzyl-3-tert-butylpyrazol-5-yl)-4-(methylamino)butanamide;hydrochloride (PubChem CID 119704768) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is N-(1-benzyl-3-tert-butylpyrazol-5-yl)-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119704768 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1cc(C(C)(C)C)nn1Cc1ccccc1.Cl |
| InChI | InChI=1S/C19H28N4O.ClH/c1-19(2,3)16-13-17(21-18(24)11-8-12-20-4)23(22-16)14-15-9-6-5-7-10-15;/h5-7,9-10,13,20H,8,11-12,14H2,1-4H3,(H,21,24);1H |
| InChIKey | ZPKRTNCUPMBVTH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|