C21H23BrN2O3S — CID 60607207
N-[1-[4-(4-bromophenyl)-4-oxobutanoyl]piperidin-4-yl]-5-methylthiophene-2-carboxamide (PubChem CID 60607207) has the molecular formula C21H23BrN2O3S and a molecular weight of 463.40 g/mol. Its IUPAC name is N-[1-[4-(4-bromophenyl)-4-oxobutanoyl]piperidin-4-yl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[1-[4-(4-bromophenyl)-4-oxobutanoyl]piperidin-4-yl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60607207 |
| Molecular Formula | C21H23BrN2O3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[1-[4-(4-bromophenyl)-4-oxobutanoyl]piperidin-4-yl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)CCC(=O)c3ccc(Br)cc3)CC2)s1 |
| InChI | InChI=1S/C21H23BrN2O3S/c1-14-2-8-19(28-14)21(27)23-17-10-12-24(13-11-17)20(26)9-7-18(25)15-3-5-16(22)6-4-15/h2-6,8,17H,7,9-13H2,1H3,(H,23,27) |
| InChIKey | MJIMXTMIIQZFPT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |