About N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide
N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide (PubChem CID 60609370) has the molecular formula C15H17F2N3O
and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide |
| PubChem CID | 60609370 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCCN(c2c(F)cc(C#N)cc2F)C1 |
| InChI | InChI=1S/C15H17F2N3O/c1-10(21)19-8-11-3-2-4-20(9-11)15-13(16)5-12(7-18)6-14(15)17/h5-6,11H,2-4,8-9H2,1H3,(H,19,21) |
| InChIKey | IVIQJMUTOAEWCF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide?
The IUPAC name of N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide (CID 60609370) is N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide.
What is the SMILES notation for N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide?
The canonical SMILES for N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide is CC(=O)NCC1CCCN(c2c(F)cc(C#N)cc2F)C1.
What is the InChIKey of N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide?
The InChIKey is IVIQJMUTOAEWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3O/c1-10(21)19-8-11-3-2-4-20(9-11)15-13(16)5-12(7-18)6-14(15)17/h5-6,11H,2-4,8-9H2,1H3,(H,19,21).
What are the key properties of N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide?
N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide has a molecular weight of 293.32 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide is sourced from PubChem (CID 60609370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).