C15H17F2N3O — CID 60609370
N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide (PubChem CID 60609370) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide.
| Compound Name | N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 60609370 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[[1-(4-cyano-2,6-difluorophenyl)piperidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCCN(c2c(F)cc(C#N)cc2F)C1 |
| InChI | InChI=1S/C15H17F2N3O/c1-10(21)19-8-11-3-2-4-20(9-11)15-13(16)5-12(7-18)6-14(15)17/h5-6,11H,2-4,8-9H2,1H3,(H,19,21) |
| InChIKey | IVIQJMUTOAEWCF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |