C14H17F2N3O3 — CID 14834664
N-[[1-(3,6-difluoro-2-methyl-4-nitrophenyl)pyrrolidin-3-yl]methyl]acetamide (PubChem CID 14834664) has the molecular formula C14H17F2N3O3 and a molecular weight of 313.30 g/mol. Its IUPAC name is N-[[1-(3,6-difluoro-2-methyl-4-nitrophenyl)pyrrolidin-3-yl]methyl]acetamide.
| Compound Name | N-[[1-(3,6-difluoro-2-methyl-4-nitrophenyl)pyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 14834664 |
| Molecular Formula | C14H17F2N3O3 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[[1-(3,6-difluoro-2-methyl-4-nitrophenyl)pyrrolidin-3-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CCN(c2c(F)cc([N+](=O)[O-])c(F)c2C)C1 |
| InChI | InChI=1S/C14H17F2N3O3/c1-8-13(16)12(19(21)22)5-11(15)14(8)18-4-3-10(7-18)6-17-9(2)20/h5,10H,3-4,6-7H2,1-2H3,(H,17,20) |
| InChIKey | CBFRYKOUCZFNRD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|