C17H21F2IN2O2 — CID 60610834
N-(3,5-difluoro-4-iodophenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide (PubChem CID 60610834) has the molecular formula C17H21F2IN2O2 and a molecular weight of 450.27 g/mol. Its IUPAC name is N-(3,5-difluoro-4-iodophenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide.
| Compound Name | N-(3,5-difluoro-4-iodophenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60610834 |
| Molecular Formula | C17H21F2IN2O2 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-(3,5-difluoro-4-iodophenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCCC(C(=O)Nc2cc(F)c(I)c(F)c2)C1 |
| InChI | InChI=1S/C17H21F2IN2O2/c1-17(2,3)16(24)22-6-4-5-10(9-22)15(23)21-11-7-12(18)14(20)13(19)8-11/h7-8,10H,4-6,9H2,1-3H3,(H,21,23) |
| InChIKey | YRUHFRAFJJUIOC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|