C18H27N3O2 — CID 120568574
N-(5-amino-2-methylphenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide (PubChem CID 120568574) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide.
| Compound Name | N-(5-amino-2-methylphenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120568574 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-1-(2,2-dimethylpropanoyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(N)cc1NC(=O)C1CCCN(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-12-7-8-14(19)10-15(12)20-16(22)13-6-5-9-21(11-13)17(23)18(2,3)4/h7-8,10,13H,5-6,9,11,19H2,1-4H3,(H,20,22) |
| InChIKey | JALPZMLMGPKISD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|