C18H29ClN4O2 — CID 120568216
3-N-(5-amino-2-methylphenyl)-1-N-(2-methylpropyl)piperidine-1,3-dicarboxamide;hydrochloride (PubChem CID 120568216) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 3-N-(5-amino-2-methylphenyl)-1-N-(2-methylpropyl)piperidine-1,3-dicarboxamide;hydrochloride.
| Compound Name | 3-N-(5-amino-2-methylphenyl)-1-N-(2-methylpropyl)piperidine-1,3-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 120568216 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-N-(5-amino-2-methylphenyl)-1-N-(2-methylpropyl)piperidine-1,3-dicarboxamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)C1CCCN(C(=O)NCC(C)C)C1.Cl |
| InChI | InChI=1S/C18H28N4O2.ClH/c1-12(2)10-20-18(24)22-8-4-5-14(11-22)17(23)21-16-9-15(19)7-6-13(16)3;/h6-7,9,12,14H,4-5,8,10-11,19H2,1-3H3,(H,20,24)(H,21,23);1H |
| InChIKey | HYTWODNURVVGBW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|