C19H26N4O2 — CID 60613258
2-[2-(1-adamantylamino)anilino]-N-carbamoylacetamide (PubChem CID 60613258) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[2-(1-adamantylamino)anilino]-N-carbamoylacetamide.
| Compound Name | 2-[2-(1-adamantylamino)anilino]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 60613258 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-[2-(1-adamantylamino)anilino]-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)CNc1ccccc1NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26N4O2/c20-18(25)22-17(24)11-21-15-3-1-2-4-16(15)23-19-8-12-5-13(9-19)7-14(6-12)10-19/h1-4,12-14,21,23H,5-11H2,(H3,20,22,24,25) |
| InChIKey | VCPWCPNYZBZDAI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |