C22H26N4O3 — CID 60590759
N-[2-(1-adamantylamino)phenyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 60590759) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[2-(1-adamantylamino)phenyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[2-(1-adamantylamino)phenyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 60590759 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[2-(1-adamantylamino)phenyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)Nc1ccccc1NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H26N4O3/c27-19-5-6-26(21(29)24-19)13-20(28)23-17-3-1-2-4-18(17)25-22-10-14-7-15(11-22)9-16(8-14)12-22/h1-6,14-16,25H,7-13H2,(H,23,28)(H,24,27,29) |
| InChIKey | BKIAAEYTCOXZDY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |