C21H28N2O2S — CID 60614756
3-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-1-(thiophen-2-ylmethyl)urea (PubChem CID 60614756) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 3-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60614756 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-1-(thiophen-2-ylmethyl)urea |
| SMILES | CCN(Cc1cccs1)C(=O)NCc1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O2S/c1-2-23(16-20-9-6-14-26-20)21(24)22-15-17-10-12-19(13-11-17)25-18-7-4-3-5-8-18/h6,9-14,18H,2-5,7-8,15-16H2,1H3,(H,22,24) |
| InChIKey | DQQZXFXPIVYOCY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |