C23H23N3O2S — CID 60617448
2-methyl-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]quinoline-4-carboxamide (PubChem CID 60617448) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-methyl-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-methyl-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 60617448 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-methyl-N-[2-methyl-4-(thiomorpholine-4-carbonyl)phenyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C(=O)N3CCSCC3)cc2C)c2ccccc2n1 |
| InChI | InChI=1S/C23H23N3O2S/c1-15-13-17(23(28)26-9-11-29-12-10-26)7-8-20(15)25-22(27)19-14-16(2)24-21-6-4-3-5-18(19)21/h3-8,13-14H,9-12H2,1-2H3,(H,25,27) |
| InChIKey | QXBMUVHFNFQTDU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |