C21H29N3O3 — CID 60618046
tert-butyl 2-[2-(dimethylamino)ethyl-(2-methylquinoline-4-carbonyl)amino]acetate (PubChem CID 60618046) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl 2-[2-(dimethylamino)ethyl-(2-methylquinoline-4-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[2-(dimethylamino)ethyl-(2-methylquinoline-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 60618046 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl 2-[2-(dimethylamino)ethyl-(2-methylquinoline-4-carbonyl)amino]acetate |
| SMILES | Cc1cc(C(=O)N(CCN(C)C)CC(=O)OC(C)(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C21H29N3O3/c1-15-13-17(16-9-7-8-10-18(16)22-15)20(26)24(12-11-23(5)6)14-19(25)27-21(2,3)4/h7-10,13H,11-12,14H2,1-6H3 |
| InChIKey | ZEZMQTMFMLLBIG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |