C19H29NO4S — CID 60622067
2-cyclopentylsulfonyl-N-[[2-(3-methylbutoxy)phenyl]methyl]acetamide (PubChem CID 60622067) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-N-[[2-(3-methylbutoxy)phenyl]methyl]acetamide.
| Compound Name | 2-cyclopentylsulfonyl-N-[[2-(3-methylbutoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 60622067 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-cyclopentylsulfonyl-N-[[2-(3-methylbutoxy)phenyl]methyl]acetamide |
| SMILES | CC(C)CCOc1ccccc1CNC(=O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C19H29NO4S/c1-15(2)11-12-24-18-10-6-3-7-16(18)13-20-19(21)14-25(22,23)17-8-4-5-9-17/h3,6-7,10,15,17H,4-5,8-9,11-14H2,1-2H3,(H,20,21) |
| InChIKey | FWBOJPLXEQNQMJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |