C22H27NO4S — CID 78884993
2-cyclopentylsulfonyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]acetamide (PubChem CID 78884993) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-cyclopentylsulfonyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 78884993 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-cyclopentylsulfonyl-N-[[2-(phenylmethoxymethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CS(=O)(=O)C1CCCC1)NCc1ccccc1COCc1ccccc1 |
| InChI | InChI=1S/C22H27NO4S/c24-22(17-28(25,26)21-12-6-7-13-21)23-14-19-10-4-5-11-20(19)16-27-15-18-8-2-1-3-9-18/h1-5,8-11,21H,6-7,12-17H2,(H,23,24) |
| InChIKey | YXYILBJRHAIWLQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |