C13H11Cl2NO2 — CID 60624435
2-(3,4-dichlorophenoxy)-1-(1-methylpyrrol-2-yl)ethanone (PubChem CID 60624435) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-1-(1-methylpyrrol-2-yl)ethanone.
| Compound Name | 2-(3,4-dichlorophenoxy)-1-(1-methylpyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 60624435 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-1-(1-methylpyrrol-2-yl)ethanone |
| SMILES | Cn1cccc1C(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO2/c1-16-6-2-3-12(16)13(17)8-18-9-4-5-10(14)11(15)7-9/h2-7H,8H2,1H3 |
| InChIKey | IXPIUCCZDMFBCY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |