C17H16Cl2O2 — CID 60626549
2-(2,6-dichlorophenoxy)-1-(4-propylphenyl)ethanone (PubChem CID 60626549) has the molecular formula C17H16Cl2O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)-1-(4-propylphenyl)ethanone.
| Compound Name | 2-(2,6-dichlorophenoxy)-1-(4-propylphenyl)ethanone |
|---|---|
| PubChem CID | 60626549 |
| Molecular Formula | C17H16Cl2O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)-1-(4-propylphenyl)ethanone |
| SMILES | CCCc1ccc(C(=O)COc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2O2/c1-2-4-12-7-9-13(10-8-12)16(20)11-21-17-14(18)5-3-6-15(17)19/h3,5-10H,2,4,11H2,1H3 |
| InChIKey | NPPZURNLOKYZMZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |