C25H19Cl3O3 — CID 6062743
(2E)-2-[[3-methoxy-4-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 6062743) has the molecular formula C25H19Cl3O3 and a molecular weight of 473.78 g/mol. Its IUPAC name is (2E)-2-[[3-methoxy-4-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[[3-methoxy-4-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 6062743 |
| Molecular Formula | C25H19Cl3O3 |
| Molecular Weight | 473.78 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | (2E)-2-[[3-methoxy-4-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | COc1cc(/C=C2\CCc3ccccc3C2=O)ccc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C25H19Cl3O3/c1-30-23-11-15(10-17-9-8-16-4-2-3-5-20(16)24(17)29)6-7-18(23)14-31-25-21(27)12-19(26)13-22(25)28/h2-7,10-13H,8-9,14H2,1H3/b17-10+ |
| InChIKey | STZJVIIUTUOOBT-LICLKQGHSA-N |
| XLogP | 7.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|