C12H27NO2 — CID 60634039
1-(dipropylamino)-3-propan-2-yloxypropan-2-ol (PubChem CID 60634039) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 1-(dipropylamino)-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-(dipropylamino)-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 60634039 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 1-(dipropylamino)-3-propan-2-yloxypropan-2-ol |
| SMILES | CCCN(CCC)CC(O)COC(C)C |
| InChI | InChI=1S/C12H27NO2/c1-5-7-13(8-6-2)9-12(14)10-15-11(3)4/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | KWTICTCHCMCPON-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |