C9H11N3O3 — CID 60636588
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-prop-2-enylacetamide (PubChem CID 60636588) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 60636588 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C9H11N3O3/c1-2-5-10-8(14)6-12-9(15)4-3-7(13)11-12/h2-4H,1,5-6H2,(H,10,14)(H,11,13) |
| InChIKey | YKQGWPTUKGAQRO-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|