C11H15N3O3 — CID 60636998
N-cyclopentyl-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide (PubChem CID 60636998) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-cyclopentyl-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide |
|---|---|
| PubChem CID | 60636998 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-cyclopentyl-2-(3,6-dioxo-1H-pyridazin-2-yl)acetamide |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NC1CCCC1 |
| InChI | InChI=1S/C11H15N3O3/c15-9-5-6-11(17)14(13-9)7-10(16)12-8-3-1-2-4-8/h5-6,8H,1-4,7H2,(H,12,16)(H,13,15) |
| InChIKey | IGIMXODDOJQSMS-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |