C15H25NO3 — CID 60653107
N,N-bis(2-hydroxyethyl)adamantane-1-carboxamide (PubChem CID 60653107) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)adamantane-1-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 60653107 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)adamantane-1-carboxamide |
| SMILES | O=C(N(CCO)CCO)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H25NO3/c17-3-1-16(2-4-18)14(19)15-8-11-5-12(9-15)7-13(6-11)10-15/h11-13,17-18H,1-10H2 |
| InChIKey | DOEYCEWCMNZCOS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |