C25H36N2O3 — CID 78855618
N-[[4-[butyl(2-hydroxyethyl)carbamoyl]phenyl]methyl]adamantane-1-carboxamide (PubChem CID 78855618) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-[[4-[butyl(2-hydroxyethyl)carbamoyl]phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[4-[butyl(2-hydroxyethyl)carbamoyl]phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 78855618 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-[[4-[butyl(2-hydroxyethyl)carbamoyl]phenyl]methyl]adamantane-1-carboxamide |
| SMILES | CCCCN(CCO)C(=O)c1ccc(CNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H36N2O3/c1-2-3-8-27(9-10-28)23(29)22-6-4-18(5-7-22)17-26-24(30)25-14-19-11-20(15-25)13-21(12-19)16-25/h4-7,19-21,28H,2-3,8-17H2,1H3,(H,26,30) |
| InChIKey | HZDDERQIDGDVNV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |