C30H48O6Si2 — CID 6066179
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane (PubChem CID 6066179) has the molecular formula C30H48O6Si2 and a molecular weight of 560.88 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 6066179 |
| Molecular Formula | C30H48O6Si2 |
| Molecular Weight | 560.88 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-6-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
| SMILES | COc1cc(/C=C/c2ccc(OC)c(O[Si](C)(C)C(C)(C)C)c2O[Si](C)(C)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C30H48O6Si2/c1-29(2,3)37(11,12)35-26-22(16-15-21-19-24(32-8)27(34-10)25(20-21)33-9)17-18-23(31-7)28(26)36-38(13,14)30(4,5)6/h15-20H,1-14H3/b16-15+ |
| InChIKey | RIQSNCUTZNZOQE-FOCLMDBBSA-N |
| XLogP | 8.66 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.88 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|