C18H18N2O — CID 60663725
N-(1H-indol-3-ylmethyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 60663725) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-(1H-indol-3-ylmethyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-(1H-indol-3-ylmethyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 60663725 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(1H-indol-3-ylmethyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | c1ccc2c(c1)OCCC2NCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H18N2O/c1-3-7-16-14(5-1)13(11-19-16)12-20-17-9-10-21-18-8-4-2-6-15(17)18/h1-8,11,17,19-20H,9-10,12H2 |
| InChIKey | RQPRBZASTSWTIW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |