C12H21N3 — CID 60663876
1-(1-ethylpyrrolidin-2-yl)-N-(1H-pyrrol-2-ylmethyl)methanamine (PubChem CID 60663876) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-2-yl)-N-(1H-pyrrol-2-ylmethyl)methanamine.
| Compound Name | 1-(1-ethylpyrrolidin-2-yl)-N-(1H-pyrrol-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 60663876 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-(1-ethylpyrrolidin-2-yl)-N-(1H-pyrrol-2-ylmethyl)methanamine |
| SMILES | CCN1CCCC1CNCc1ccc[nH]1 |
| InChI | InChI=1S/C12H21N3/c1-2-15-8-4-6-12(15)10-13-9-11-5-3-7-14-11/h3,5,7,12-14H,2,4,6,8-10H2,1H3 |
| InChIKey | QYCBTEWZLSIOOE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |