C11H18N2O2S — CID 60664920
4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylbutanamide (PubChem CID 60664920) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylbutanamide.
| Compound Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylbutanamide |
|---|---|
| PubChem CID | 60664920 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-(4-methyl-2-oxo-1,3-thiazol-3-yl)-N-propylbutanamide |
| SMILES | CCCNC(=O)CCCn1c(C)csc1=O |
| InChI | InChI=1S/C11H18N2O2S/c1-3-6-12-10(14)5-4-7-13-9(2)8-16-11(13)15/h8H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | QTHXXCMEHRYJTH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |