C11H12N2O3S — CID 60665758
4-(benzimidazol-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 60665758) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(benzimidazol-1-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60665758 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-(benzimidazol-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(n2cnc3ccccc32)C1 |
| InChI | InChI=1S/C11H12N2O3S/c14-11-6-17(15,16)5-10(11)13-7-12-8-3-1-2-4-9(8)13/h1-4,7,10-11,14H,5-6H2 |
| InChIKey | HITKEVWVUZNBGI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |