C11H15N3O2 — CID 60671281
2-anilino-N-[2-(methylamino)-2-oxoethyl]acetamide (PubChem CID 60671281) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-anilino-N-[2-(methylamino)-2-oxoethyl]acetamide.
| Compound Name | 2-anilino-N-[2-(methylamino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60671281 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-anilino-N-[2-(methylamino)-2-oxoethyl]acetamide |
| SMILES | CNC(=O)CNC(=O)CNc1ccccc1 |
| InChI | InChI=1S/C11H15N3O2/c1-12-10(15)7-14-11(16)8-13-9-5-3-2-4-6-9/h2-6,13H,7-8H2,1H3,(H,12,15)(H,14,16) |
| InChIKey | MUAZGMOZOZJRMJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |