C8H18N2OS — CID 60672762
N-ethyl-2-(2-methylsulfanylethylamino)propanamide (PubChem CID 60672762) has the molecular formula C8H18N2OS and a molecular weight of 190.31 g/mol. Its IUPAC name is N-ethyl-2-(2-methylsulfanylethylamino)propanamide.
| Compound Name | N-ethyl-2-(2-methylsulfanylethylamino)propanamide |
|---|---|
| PubChem CID | 60672762 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-ethyl-2-(2-methylsulfanylethylamino)propanamide |
| SMILES | CCNC(=O)C(C)NCCSC |
| InChI | InChI=1S/C8H18N2OS/c1-4-9-8(11)7(2)10-5-6-12-3/h7,10H,4-6H2,1-3H3,(H,9,11) |
| InChIKey | FSEYBTGZGPRXHU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|