C9H11NO2 — CID 60675996
N-cyclopropyl-3-methylfuran-2-carboxamide (PubChem CID 60675996) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is N-cyclopropyl-3-methylfuran-2-carboxamide.
| Compound Name | N-cyclopropyl-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 60675996 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N-cyclopropyl-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NC1CC1 |
| InChI | InChI=1S/C9H11NO2/c1-6-4-5-12-8(6)9(11)10-7-2-3-7/h4-5,7H,2-3H2,1H3,(H,10,11) |
| InChIKey | LFDROIQSVGZISH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |