C19H21N5O2 — CID 176502237
3-methyl-N-[4-(4-pyrazin-2-ylpyrazol-1-yl)cyclohexyl]furan-2-carboxamide (PubChem CID 176502237) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-methyl-N-[4-(4-pyrazin-2-ylpyrazol-1-yl)cyclohexyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[4-(4-pyrazin-2-ylpyrazol-1-yl)cyclohexyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 176502237 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-methyl-N-[4-(4-pyrazin-2-ylpyrazol-1-yl)cyclohexyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NC1CCC(n2cc(-c3cnccn3)cn2)CC1 |
| InChI | InChI=1S/C19H21N5O2/c1-13-6-9-26-18(13)19(25)23-15-2-4-16(5-3-15)24-12-14(10-22-24)17-11-20-7-8-21-17/h6-12,15-16H,2-5H2,1H3,(H,23,25) |
| InChIKey | RUBQBVHIOPBFLK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |