C20H21FN6O — CID 175645470
1-(2-fluorophenyl)-3-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]urea (PubChem CID 175645470) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]urea |
|---|---|
| PubChem CID | 175645470 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]urea |
| SMILES | O=C(Nc1ccccc1F)NC1CCC(n2cc(-c3ccncn3)cn2)CC1 |
| InChI | InChI=1S/C20H21FN6O/c21-17-3-1-2-4-19(17)26-20(28)25-15-5-7-16(8-6-15)27-12-14(11-24-27)18-9-10-22-13-23-18/h1-4,9-13,15-16H,5-8H2,(H2,25,26,28) |
| InChIKey | XENJILSBQVCRJA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |