C19H21N5OS — CID 175644648
5-methyl-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]thiophene-2-carboxamide (PubChem CID 175644648) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 5-methyl-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 175644648 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 5-methyl-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCC(n3cc(-c4ccncn4)cn3)CC2)s1 |
| InChI | InChI=1S/C19H21N5OS/c1-13-2-7-18(26-13)19(25)23-15-3-5-16(6-4-15)24-11-14(10-22-24)17-8-9-20-12-21-17/h2,7-12,15-16H,3-6H2,1H3,(H,23,25) |
| InChIKey | NRKCBIHKDSRMSL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |