C21H21ClFN5O — CID 175645939
2-(2-chloro-4-fluorophenyl)-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]acetamide (PubChem CID 175645939) has the molecular formula C21H21ClFN5O and a molecular weight of 413.88 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]acetamide.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 175645939 |
| Molecular Formula | C21H21ClFN5O |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-N-[4-(4-pyrimidin-4-ylpyrazol-1-yl)cyclohexyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1Cl)NC1CCC(n2cc(-c3ccncn3)cn2)CC1 |
| InChI | InChI=1S/C21H21ClFN5O/c22-19-10-16(23)2-1-14(19)9-21(29)27-17-3-5-18(6-4-17)28-12-15(11-26-28)20-7-8-24-13-25-20/h1-2,7-8,10-13,17-18H,3-6,9H2,(H,27,29) |
| InChIKey | JGYGXGHUPJWUOP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |