C13H13ClN2O4 — CID 60676350
4-chloro-2-[2-[2-cyanoethyl(methyl)amino]-2-oxoethoxy]benzoic acid (PubChem CID 60676350) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 4-chloro-2-[2-[2-cyanoethyl(methyl)amino]-2-oxoethoxy]benzoic acid.
| Compound Name | 4-chloro-2-[2-[2-cyanoethyl(methyl)amino]-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 60676350 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-chloro-2-[2-[2-cyanoethyl(methyl)amino]-2-oxoethoxy]benzoic acid |
| SMILES | CN(CCC#N)C(=O)COc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C13H13ClN2O4/c1-16(6-2-5-15)12(17)8-20-11-7-9(14)3-4-10(11)13(18)19/h3-4,7H,2,6,8H2,1H3,(H,18,19) |
| InChIKey | XMKGFBIOTHIUAR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |