C18H24N2 — CID 60678085
4-[(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)methyl]benzonitrile (PubChem CID 60678085) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)methyl]benzonitrile.
| Compound Name | 4-[(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 60678085 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-[(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNC2CCC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C18H24N2/c19-12-14-5-7-15(8-6-14)13-20-18-10-9-16-3-1-2-4-17(16)11-18/h5-8,16-18,20H,1-4,9-11,13H2 |
| InChIKey | UQJQOMBWAJTLKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |