C14H11Cl2NO3 — CID 60678494
2-(2,4-dichlorophenoxy)-4,6-dimethylpyridine-3-carboxylic acid (PubChem CID 60678494) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-4,6-dimethylpyridine-3-carboxylic acid.
| Compound Name | 2-(2,4-dichlorophenoxy)-4,6-dimethylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 60678494 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-4,6-dimethylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H11Cl2NO3/c1-7-5-8(2)17-13(12(7)14(18)19)20-11-4-3-9(15)6-10(11)16/h3-6H,1-2H3,(H,18,19) |
| InChIKey | XQJWBBHKMQUQAF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |