C19H23ClN2O4 — CID 141037315
2-(4-chloro-2-methoxyphenoxy)-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylic acid (PubChem CID 141037315) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxyphenoxy)-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 2-(4-chloro-2-methoxyphenoxy)-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 141037315 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-(4-chloro-2-methoxyphenoxy)-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylic acid |
| SMILES | CCC(CC)Nc1cc(C)nc(Oc2ccc(Cl)cc2OC)c1C(=O)O |
| InChI | InChI=1S/C19H23ClN2O4/c1-5-13(6-2)22-14-9-11(3)21-18(17(14)19(23)24)26-15-8-7-12(20)10-16(15)25-4/h7-10,13H,5-6H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | YEXXPLGEFXWSCH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |