C13H19ClN2O2 — CID 24806876
methyl 2-chloro-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylate (PubChem CID 24806876) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is methyl 2-chloro-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylate.
| Compound Name | methyl 2-chloro-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 24806876 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 2-chloro-6-methyl-4-(pentan-3-ylamino)pyridine-3-carboxylate |
| SMILES | CCC(CC)Nc1cc(C)nc(Cl)c1C(=O)OC |
| InChI | InChI=1S/C13H19ClN2O2/c1-5-9(6-2)16-10-7-8(3)15-12(14)11(10)13(17)18-4/h7,9H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | UOCYHMFGIGNJFT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|