C14H18F2N2O3 — CID 60680853
2-[[2-(3,4-difluorophenyl)-2-oxoethyl]-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 60680853) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[[2-(3,4-difluorophenyl)-2-oxoethyl]-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[2-(3,4-difluorophenyl)-2-oxoethyl]-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 60680853 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[[2-(3,4-difluorophenyl)-2-oxoethyl]-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)CC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H18F2N2O3/c1-18(9-14(20)17-5-6-21-2)8-13(19)10-3-4-11(15)12(16)7-10/h3-4,7H,5-6,8-9H2,1-2H3,(H,17,20) |
| InChIKey | VPQDBEOZCDGZCY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|