C12H15BrN2O2S — CID 60681800
2-[[2-(5-bromothiophen-2-yl)-2-oxoethyl]-methylamino]-N-cyclopropylacetamide (PubChem CID 60681800) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-[[2-(5-bromothiophen-2-yl)-2-oxoethyl]-methylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[[2-(5-bromothiophen-2-yl)-2-oxoethyl]-methylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 60681800 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-[[2-(5-bromothiophen-2-yl)-2-oxoethyl]-methylamino]-N-cyclopropylacetamide |
| SMILES | CN(CC(=O)NC1CC1)CC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H15BrN2O2S/c1-15(7-12(17)14-8-2-3-8)6-9(16)10-4-5-11(13)18-10/h4-5,8H,2-3,6-7H2,1H3,(H,14,17) |
| InChIKey | MTNCGDZXBKAFBE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |