C12H16BrNOS — CID 62860457
1-(5-bromothiophen-2-yl)-2-[cyclobutylmethyl(methyl)amino]ethanone (PubChem CID 62860457) has the molecular formula C12H16BrNOS and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-[cyclobutylmethyl(methyl)amino]ethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-[cyclobutylmethyl(methyl)amino]ethanone |
|---|---|
| PubChem CID | 62860457 |
| Molecular Formula | C12H16BrNOS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-[cyclobutylmethyl(methyl)amino]ethanone |
| SMILES | CN(CC(=O)c1ccc(Br)s1)CC1CCC1 |
| InChI | InChI=1S/C12H16BrNOS/c1-14(7-9-3-2-4-9)8-10(15)11-5-6-12(13)16-11/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | WBUZWUZDLKSISR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |