C20H31N3O4 — CID 6068548
(3E)-3-[[2-(4-tert-butylphenoxy)acetyl]hydrazinylidene]-N-(3-methoxypropyl)butanamide (PubChem CID 6068548) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is (3E)-3-[[2-(4-tert-butylphenoxy)acetyl]hydrazinylidene]-N-(3-methoxypropyl)butanamide.
| Compound Name | (3E)-3-[[2-(4-tert-butylphenoxy)acetyl]hydrazinylidene]-N-(3-methoxypropyl)butanamide |
|---|---|
| PubChem CID | 6068548 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (3E)-3-[[2-(4-tert-butylphenoxy)acetyl]hydrazinylidene]-N-(3-methoxypropyl)butanamide |
| SMILES | COCCCNC(=O)C/C(C)=N/NC(=O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H31N3O4/c1-15(13-18(24)21-11-6-12-26-5)22-23-19(25)14-27-17-9-7-16(8-10-17)20(2,3)4/h7-10H,6,11-14H2,1-5H3,(H,21,24)(H,23,25)/b22-15+ |
| InChIKey | VOOGESHMZWIIBB-PXLXIMEGSA-N |
| XLogP | 2.40 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|