C11H21N3 — CID 60688742
5-(4-methyl-1,4-diazepan-1-yl)pentanenitrile (PubChem CID 60688742) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 5-(4-methyl-1,4-diazepan-1-yl)pentanenitrile.
| Compound Name | 5-(4-methyl-1,4-diazepan-1-yl)pentanenitrile |
|---|---|
| PubChem CID | 60688742 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 5-(4-methyl-1,4-diazepan-1-yl)pentanenitrile |
| SMILES | CN1CCCN(CCCCC#N)CC1 |
| InChI | InChI=1S/C11H21N3/c1-13-7-5-9-14(11-10-13)8-4-2-3-6-12/h2-5,7-11H2,1H3 |
| InChIKey | ZGIDYOREGOZBPZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|