C13H25N3O5 — CID 60692355
methyl 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-4-methylpentanoate (PubChem CID 60692355) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 60692355 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | methyl 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-4-methylpentanoate |
| SMILES | COCCNC(=O)NC(=O)CNC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C13H25N3O5/c1-9(2)7-10(12(18)21-4)15-8-11(17)16-13(19)14-5-6-20-3/h9-10,15H,5-8H2,1-4H3,(H2,14,16,17,19) |
| InChIKey | BAGOACXKZFIMTD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|