C15H30N2O4 — CID 16682459
methyl (2S)-2-(3-butoxypropylcarbamoylamino)-3-methylpentanoate (PubChem CID 16682459) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is methyl (2S)-2-(3-butoxypropylcarbamoylamino)-3-methylpentanoate.
| Compound Name | methyl (2S)-2-(3-butoxypropylcarbamoylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 16682459 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | methyl (2S)-2-(3-butoxypropylcarbamoylamino)-3-methylpentanoate |
| SMILES | CCCCOCCCNC(=O)N[C@H](C(=O)OC)C(C)CC |
| InChI | InChI=1S/C15H30N2O4/c1-5-7-10-21-11-8-9-16-15(19)17-13(12(3)6-2)14(18)20-4/h12-13H,5-11H2,1-4H3,(H2,16,17,19)/t12?,13-/m0/s1 |
| InChIKey | XAHJMFMRXKERND-ABLWVSNPSA-N |
| XLogP | 2.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|