C14H29N3O3 — CID 60696906
2-[ethyl-[2-[2-hydroxyethyl(propan-2-yl)amino]acetyl]amino]-N-propan-2-ylacetamide (PubChem CID 60696906) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[ethyl-[2-[2-hydroxyethyl(propan-2-yl)amino]acetyl]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[ethyl-[2-[2-hydroxyethyl(propan-2-yl)amino]acetyl]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 60696906 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-[ethyl-[2-[2-hydroxyethyl(propan-2-yl)amino]acetyl]amino]-N-propan-2-ylacetamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)CN(CCO)C(C)C |
| InChI | InChI=1S/C14H29N3O3/c1-6-16(9-13(19)15-11(2)3)14(20)10-17(7-8-18)12(4)5/h11-12,18H,6-10H2,1-5H3,(H,15,19) |
| InChIKey | GYCXHZRSMOCCKY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |