C10H20N2O3 — CID 60652174
ethyl N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]carbamate (PubChem CID 60652174) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]carbamate.
| Compound Name | ethyl N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 60652174 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethyl N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]carbamate |
| SMILES | CCOC(=O)N(CC)CC(=O)NC(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-5-12(10(14)15-6-2)7-9(13)11-8(3)4/h8H,5-7H2,1-4H3,(H,11,13) |
| InChIKey | DYWVKOKWNRRBGW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |