C12H22N2O4 — CID 82821282
3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82821282) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82821282 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H22N2O4/c1-6-14(7-9(15)13-8(2)3)10(16)12(4,5)11(17)18/h8H,6-7H2,1-5H3,(H,13,15)(H,17,18) |
| InChIKey | WYHUQEJVZOFKRG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|