C10H18N2O4 — CID 82821374
3-[ethyl-[2-(methylamino)-2-oxoethyl]amino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82821374) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-[ethyl-[2-(methylamino)-2-oxoethyl]amino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[ethyl-[2-(methylamino)-2-oxoethyl]amino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82821374 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-[ethyl-[2-(methylamino)-2-oxoethyl]amino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CCN(CC(=O)NC)C(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C10H18N2O4/c1-5-12(6-7(13)11-4)8(14)10(2,3)9(15)16/h5-6H2,1-4H3,(H,11,13)(H,15,16) |
| InChIKey | DVUSZMHQLMUBJN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|